C8H8BrN5 — CID 114869714
1-(5-bromo-4-methyl-2-pyridinyl)-1,2,4-triazol-3-amine (PubChem CID 114869714) has the molecular formula C8H8BrN5 and a molecular weight of 254.09 g/mol. Its IUPAC name is 1-(5-bromo-4-methyl-2-pyridinyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(5-bromo-4-methyl-2-pyridinyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 114869714 |
| Molecular Formula | C8H8BrN5 |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 1-(5-bromo-4-methyl-2-pyridinyl)-1,2,4-triazol-3-amine |
| SMILES | Cc1cc(-n2cnc(N)n2)ncc1Br |
| InChI | InChI=1S/C8H8BrN5/c1-5-2-7(11-3-6(5)9)14-4-12-8(10)13-14/h2-4H,1H3,(H2,10,13) |
| InChIKey | RLGUZHCDIDDVHU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |