C18H22FN5O4 — CID 11487043
1-ethyl-6-fluoro-7-[4-(2-hydrazinyl-2-oxoethyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 11487043) has the molecular formula C18H22FN5O4 and a molecular weight of 391.40 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-7-[4-(2-hydrazinyl-2-oxoethyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-fluoro-7-[4-(2-hydrazinyl-2-oxoethyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11487043 |
| Molecular Formula | C18H22FN5O4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-ethyl-6-fluoro-7-[4-(2-hydrazinyl-2-oxoethyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(CC(=O)NN)CC3)cc21 |
| InChI | InChI=1S/C18H22FN5O4/c1-2-23-9-12(18(27)28)17(26)11-7-13(19)15(8-14(11)23)24-5-3-22(4-6-24)10-16(25)21-20/h7-9H,2-6,10,20H2,1H3,(H,21,25)(H,27,28) |
| InChIKey | JHTJMWFRPWBNGT-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|