C29H34FN5O7 — CID 71508484
7-[4-[2-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-2-oxoethyl]piperazin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 71508484) has the molecular formula C29H34FN5O7 and a molecular weight of 583.62 g/mol. Its IUPAC name is 7-[4-[2-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-2-oxoethyl]piperazin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[4-[2-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-2-oxoethyl]piperazin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71508484 |
| Molecular Formula | C29H34FN5O7 |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 7-[4-[2-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-2-oxoethyl]piperazin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(CC(=O)NCCCCNC(=O)c4cccc(O)c4O)CC3)cc21 |
| InChI | InChI=1S/C29H34FN5O7/c1-2-34-16-20(29(41)42)26(38)19-14-21(30)23(15-22(19)34)35-12-10-33(11-13-35)17-25(37)31-8-3-4-9-32-28(40)18-6-5-7-24(36)27(18)39/h5-7,14-16,36,39H,2-4,8-13,17H2,1H3,(H,31,37)(H,32,40)(H,41,42) |
| InChIKey | UVNSTXWOGSMQNR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 164.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|