C12H14BrN3O2 — CID 114870471
4-(5-bromo-4-methyl-2-pyridinyl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 114870471) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 4-(5-bromo-4-methyl-2-pyridinyl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(5-bromo-4-methyl-2-pyridinyl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 114870471 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-(5-bromo-4-methyl-2-pyridinyl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | Cc1cc(N2CC(=O)NC(=O)C2(C)C)ncc1Br |
| InChI | InChI=1S/C12H14BrN3O2/c1-7-4-9(14-5-8(7)13)16-6-10(17)15-11(18)12(16,2)3/h4-5H,6H2,1-3H3,(H,15,17,18) |
| InChIKey | NLUVOFXHJGRVSH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|