C24H44O4Si — CID 11487089
(4aR,8R,8aS)-2,2-ditert-butyl-8-dec-1-en-2-yloxy-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline (PubChem CID 11487089) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (4aR,8R,8aS)-2,2-ditert-butyl-8-dec-1-en-2-yloxy-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline.
| Compound Name | (4aR,8R,8aS)-2,2-ditert-butyl-8-dec-1-en-2-yloxy-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline |
|---|---|
| PubChem CID | 11487089 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (4aR,8R,8aS)-2,2-ditert-butyl-8-dec-1-en-2-yloxy-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline |
| SMILES | C=C(CCCCCCCC)O[C@@H]1C=CO[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12 |
| InChI | InChI=1S/C24H44O4Si/c1-9-10-11-12-13-14-15-19(2)27-20-16-17-25-21-18-26-29(23(3,4)5,24(6,7)8)28-22(20)21/h16-17,20-22H,2,9-15,18H2,1,3-8H3/t20-,21-,22+/m1/s1 |
| InChIKey | BPIANZQPWKXLOT-VSKRKVRLSA-N |
| XLogP | 7.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|