C23H42O5Si — CID 11201151
[(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] nonanoate (PubChem CID 11201151) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is [(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] nonanoate.
| Compound Name | [(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] nonanoate |
|---|---|
| PubChem CID | 11201151 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | [(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)O[C@@H]1C=CO[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12 |
| InChI | InChI=1S/C23H42O5Si/c1-8-9-10-11-12-13-14-20(24)27-18-15-16-25-19-17-26-29(22(2,3)4,23(5,6)7)28-21(18)19/h15-16,18-19,21H,8-14,17H2,1-7H3/t18-,19-,21+/m1/s1 |
| InChIKey | WMMIWKHRSZBKAP-SBHAEUEKSA-N |
| XLogP | 6.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|