C18H26FN — CID 114871004
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-1-(3-fluorophenyl)propan-1-amine (PubChem CID 114871004) has the molecular formula C18H26FN and a molecular weight of 275.41 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-1-(3-fluorophenyl)propan-1-amine.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-1-(3-fluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 114871004 |
| Molecular Formula | C18H26FN |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-1-(3-fluorophenyl)propan-1-amine |
| SMILES | CCC(NC(C)C1CC2CCC1C2)c1cccc(F)c1 |
| InChI | InChI=1S/C18H26FN/c1-3-18(15-5-4-6-16(19)11-15)20-12(2)17-10-13-7-8-14(17)9-13/h4-6,11-14,17-18,20H,3,7-10H2,1-2H3 |
| InChIKey | VUYUYJQMZYRGIK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |