C16H21Cl3N2O3S — CID 11487166
N-(3-chloropropyl)-N-(3,4-dichlorophenyl)-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 11487166) has the molecular formula C16H21Cl3N2O3S and a molecular weight of 427.78 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-(3,4-dichlorophenyl)-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-chloropropyl)-N-(3,4-dichlorophenyl)-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 11487166 |
| Molecular Formula | C16H21Cl3N2O3S |
| Molecular Weight | 427.78 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-(3-chloropropyl)-N-(3,4-dichlorophenyl)-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N(CCCCl)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21Cl3N2O3S/c1-25(23,24)20-9-5-12(6-10-20)16(22)21(8-2-7-17)13-3-4-14(18)15(19)11-13/h3-4,11-12H,2,5-10H2,1H3 |
| InChIKey | OEFTUORLRMWQFU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|