C11H17FN2 — CID 114871774
2-[1-(3-fluorophenyl)propyl]-1,1-dimethylhydrazine (PubChem CID 114871774) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)propyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[1-(3-fluorophenyl)propyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 114871774 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 2-[1-(3-fluorophenyl)propyl]-1,1-dimethylhydrazine |
| SMILES | CCC(NN(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C11H17FN2/c1-4-11(13-14(2)3)9-6-5-7-10(12)8-9/h5-8,11,13H,4H2,1-3H3 |
| InChIKey | WAKHGLUXECADEV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|