About ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate
ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate (PubChem CID 114873026) has the molecular formula C17H26FNO2
and a molecular weight of 295.40 g/mol. Its IUPAC name is ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate.
Molecular Properties
| Compound Name | ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate |
| PubChem CID | 114873026 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate |
| SMILES | CCOC(=O)CC(CC)(c1cccc(F)c1)N(CC)CC |
| InChI | InChI=1S/C17H26FNO2/c1-5-17(19(6-2)7-3,13-16(20)21-8-4)14-10-9-11-15(18)12-14/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | TXKOFQYCYYCPDP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate?
The IUPAC name of ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate (CID 114873026) is ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate.
What is the SMILES notation for ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate?
The canonical SMILES for ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate is CCOC(=O)CC(CC)(c1cccc(F)c1)N(CC)CC.
What is the InChIKey of ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate?
The InChIKey is TXKOFQYCYYCPDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26FNO2/c1-5-17(19(6-2)7-3,13-16(20)21-8-4)14-10-9-11-15(18)12-14/h9-12H,5-8,13H2,1-4H3.
What are the key properties of ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate?
ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate has a molecular weight of 295.40 g/mol, XLogP of 3.73, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(diethylamino)-3-(3-fluorophenyl)pentanoate is sourced from PubChem (CID 114873026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).