C15H14BrFN2S — CID 114882059
2-bromo-6-[(4-fluorophenyl)methyl-methylamino]benzenecarbothioamide (PubChem CID 114882059) has the molecular formula C15H14BrFN2S and a molecular weight of 353.26 g/mol. Its IUPAC name is 2-bromo-6-[(4-fluorophenyl)methyl-methylamino]benzenecarbothioamide.
| Compound Name | 2-bromo-6-[(4-fluorophenyl)methyl-methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114882059 |
| Molecular Formula | C15H14BrFN2S |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2-bromo-6-[(4-fluorophenyl)methyl-methylamino]benzenecarbothioamide |
| SMILES | CN(Cc1ccc(F)cc1)c1cccc(Br)c1C(N)=S |
| InChI | InChI=1S/C15H14BrFN2S/c1-19(9-10-5-7-11(17)8-6-10)13-4-2-3-12(16)14(13)15(18)20/h2-8H,9H2,1H3,(H2,18,20) |
| InChIKey | DMRMGMPMBUGXOZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|