C14H18BrN3OS — CID 114882691
2-bromo-6-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]benzenecarbothioamide (PubChem CID 114882691) has the molecular formula C14H18BrN3OS and a molecular weight of 356.29 g/mol. Its IUPAC name is 2-bromo-6-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]benzenecarbothioamide.
| Compound Name | 2-bromo-6-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114882691 |
| Molecular Formula | C14H18BrN3OS |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-bromo-6-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]benzenecarbothioamide |
| SMILES | NC(=S)c1c(Br)cccc1NCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C14H18BrN3OS/c15-10-4-3-5-11(13(10)14(16)20)17-7-6-12(19)18-8-1-2-9-18/h3-5,17H,1-2,6-9H2,(H2,16,20) |
| InChIKey | UDXLMSCMUMUFCZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|