C16H24BrN3O — CID 114884984
2-bromo-6-[2-(cycloheptylamino)ethylamino]benzamide (PubChem CID 114884984) has the molecular formula C16H24BrN3O and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-bromo-6-[2-(cycloheptylamino)ethylamino]benzamide.
| Compound Name | 2-bromo-6-[2-(cycloheptylamino)ethylamino]benzamide |
|---|---|
| PubChem CID | 114884984 |
| Molecular Formula | C16H24BrN3O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-bromo-6-[2-(cycloheptylamino)ethylamino]benzamide |
| SMILES | NC(=O)c1c(Br)cccc1NCCNC1CCCCCC1 |
| InChI | InChI=1S/C16H24BrN3O/c17-13-8-5-9-14(15(13)16(18)21)20-11-10-19-12-6-3-1-2-4-7-12/h5,8-9,12,19-20H,1-4,6-7,10-11H2,(H2,18,21) |
| InChIKey | VBOXWIXIFKTXDK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|