C30H39NO4 — CID 11488414
5-[2-[(1R)-1-[(2R)-2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propoxy]ethyl]phenyl]pentanoic acid (PubChem CID 11488414) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is 5-[2-[(1R)-1-[(2R)-2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propoxy]ethyl]phenyl]pentanoic acid.
| Compound Name | 5-[2-[(1R)-1-[(2R)-2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propoxy]ethyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 11488414 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 5-[2-[(1R)-1-[(2R)-2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propoxy]ethyl]phenyl]pentanoic acid |
| SMILES | C[C@@H](OC[C@H](O)CNC(C)(C)Cc1ccc2ccccc2c1)c1ccccc1CCCCC(=O)O |
| InChI | InChI=1S/C30H39NO4/c1-22(28-14-8-6-11-25(28)12-7-9-15-29(33)34)35-21-27(32)20-31-30(2,3)19-23-16-17-24-10-4-5-13-26(24)18-23/h4-6,8,10-11,13-14,16-18,22,27,31-32H,7,9,12,15,19-21H2,1-3H3,(H,33,34)/t22-,27-/m1/s1 |
| InChIKey | YUJCEKCNTXDAKO-AJTFRIOCSA-N |
| XLogP | 5.69 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|