C27H35NO2 — CID 20812659
1-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]-3-(2-methyl-1-phenylpropoxy)propan-2-ol (PubChem CID 20812659) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is 1-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]-3-(2-methyl-1-phenylpropoxy)propan-2-ol.
| Compound Name | 1-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]-3-(2-methyl-1-phenylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 20812659 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 1-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]-3-(2-methyl-1-phenylpropoxy)propan-2-ol |
| SMILES | CC(C)C(OCC(O)CNC(C)(C)Cc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C27H35NO2/c1-20(2)26(23-11-6-5-7-12-23)30-19-25(29)18-28-27(3,4)17-21-14-15-22-10-8-9-13-24(22)16-21/h5-16,20,25-26,28-29H,17-19H2,1-4H3 |
| InChIKey | IICXUBMRVLNRHY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |