C13H9BrF2N2OS — CID 114884290
2-bromo-6-(3,4-difluorophenyl)sulfanyl-N'-hydroxybenzenecarboximidamide (PubChem CID 114884290) has the molecular formula C13H9BrF2N2OS and a molecular weight of 359.20 g/mol. Its IUPAC name is 2-bromo-6-(3,4-difluorophenyl)sulfanyl-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-bromo-6-(3,4-difluorophenyl)sulfanyl-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114884290 |
| Molecular Formula | C13H9BrF2N2OS |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 2-bromo-6-(3,4-difluorophenyl)sulfanyl-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1c(Br)cccc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H9BrF2N2OS/c14-8-2-1-3-11(12(8)13(17)18-19)20-7-4-5-9(15)10(16)6-7/h1-6,19H,(H2,17,18) |
| InChIKey | JYHJKWFFMBVHDF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|