C16H19ClFN3 — CID 114886614
3-[(5-chloro-2-fluorophenyl)-(propylamino)methyl]-4-methylpyridin-2-amine (PubChem CID 114886614) has the molecular formula C16H19ClFN3 and a molecular weight of 307.80 g/mol. Its IUPAC name is 3-[(5-chloro-2-fluorophenyl)-(propylamino)methyl]-4-methylpyridin-2-amine.
| Compound Name | 3-[(5-chloro-2-fluorophenyl)-(propylamino)methyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 114886614 |
| Molecular Formula | C16H19ClFN3 |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-[(5-chloro-2-fluorophenyl)-(propylamino)methyl]-4-methylpyridin-2-amine |
| SMILES | CCCNC(c1cc(Cl)ccc1F)c1c(C)ccnc1N |
| InChI | InChI=1S/C16H19ClFN3/c1-3-7-20-15(12-9-11(17)4-5-13(12)18)14-10(2)6-8-21-16(14)19/h4-6,8-9,15,20H,3,7H2,1-2H3,(H2,19,21) |
| InChIKey | DWFLNFIMRNCUIP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |