C13H23N3O2 — CID 79493587
3-[2,2-dimethoxy-1-(propylamino)ethyl]-4-methylpyridin-2-amine (PubChem CID 79493587) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-[2,2-dimethoxy-1-(propylamino)ethyl]-4-methylpyridin-2-amine.
| Compound Name | 3-[2,2-dimethoxy-1-(propylamino)ethyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79493587 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-[2,2-dimethoxy-1-(propylamino)ethyl]-4-methylpyridin-2-amine |
| SMILES | CCCNC(c1c(C)ccnc1N)C(OC)OC |
| InChI | InChI=1S/C13H23N3O2/c1-5-7-15-11(13(17-3)18-4)10-9(2)6-8-16-12(10)14/h6,8,11,13,15H,5,7H2,1-4H3,(H2,14,16) |
| InChIKey | JXVXABWIZGYUQQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|