C10H11BrFN — CID 114886934
1-(2-bromo-6-fluorophenyl)-N-methylprop-2-en-1-amine (PubChem CID 114886934) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)-N-methylprop-2-en-1-amine.
| Compound Name | 1-(2-bromo-6-fluorophenyl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 114886934 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)-N-methylprop-2-en-1-amine |
| SMILES | C=CC(NC)c1c(F)cccc1Br |
| InChI | InChI=1S/C10H11BrFN/c1-3-9(13-2)10-7(11)5-4-6-8(10)12/h3-6,9,13H,1H2,2H3 |
| InChIKey | KJMHRUNAMZSKNN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|