C10H10BrF2N — CID 107538944
1-(2-bromo-3,4-difluorophenyl)-N-methylprop-2-en-1-amine (PubChem CID 107538944) has the molecular formula C10H10BrF2N and a molecular weight of 262.10 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-N-methylprop-2-en-1-amine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 107538944 |
| Molecular Formula | C10H10BrF2N |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-N-methylprop-2-en-1-amine |
| SMILES | C=CC(NC)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C10H10BrF2N/c1-3-8(14-2)6-4-5-7(12)10(13)9(6)11/h3-5,8,14H,1H2,2H3 |
| InChIKey | NTKFDNQVIFMRPW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|