C15H19BrN2OS2 — CID 114889363
3-amino-4-bromo-N-methyl-N-(4-methylsulfanylbutan-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 114889363) has the molecular formula C15H19BrN2OS2 and a molecular weight of 387.37 g/mol. Its IUPAC name is 3-amino-4-bromo-N-methyl-N-(4-methylsulfanylbutan-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-bromo-N-methyl-N-(4-methylsulfanylbutan-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114889363 |
| Molecular Formula | C15H19BrN2OS2 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 3-amino-4-bromo-N-methyl-N-(4-methylsulfanylbutan-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | CSCCC(C)N(C)C(=O)c1sc2cccc(Br)c2c1N |
| InChI | InChI=1S/C15H19BrN2OS2/c1-9(7-8-20-3)18(2)15(19)14-13(17)12-10(16)5-4-6-11(12)21-14/h4-6,9H,7-8,17H2,1-3H3 |
| InChIKey | KJZOFVYYXJQEKZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |