C14H14BrN3OS — CID 114889066
3-amino-4-bromo-N-(2-cyanoethyl)-N-ethyl-1-benzothiophene-2-carboxamide (PubChem CID 114889066) has the molecular formula C14H14BrN3OS and a molecular weight of 352.26 g/mol. Its IUPAC name is 3-amino-4-bromo-N-(2-cyanoethyl)-N-ethyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-bromo-N-(2-cyanoethyl)-N-ethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114889066 |
| Molecular Formula | C14H14BrN3OS |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 3-amino-4-bromo-N-(2-cyanoethyl)-N-ethyl-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CCC#N)C(=O)c1sc2cccc(Br)c2c1N |
| InChI | InChI=1S/C14H14BrN3OS/c1-2-18(8-4-7-16)14(19)13-12(17)11-9(15)5-3-6-10(11)20-13/h3,5-6H,2,4,8,17H2,1H3 |
| InChIKey | OITJALTYHUUYNH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |