C15H16FN3OS — CID 79516002
3-amino-N-(2-cyanopropyl)-N-ethyl-4-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 79516002) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-amino-N-(2-cyanopropyl)-N-ethyl-4-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-N-(2-cyanopropyl)-N-ethyl-4-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79516002 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-amino-N-(2-cyanopropyl)-N-ethyl-4-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC(C)C#N)C(=O)c1sc2cccc(F)c2c1N |
| InChI | InChI=1S/C15H16FN3OS/c1-3-19(8-9(2)7-17)15(20)14-13(18)12-10(16)5-4-6-11(12)21-14/h4-6,9H,3,8,18H2,1-2H3 |
| InChIKey | ASZLMBQVGDPEIP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |