C16H21FN2OS — CID 79516852
3-amino-4-fluoro-N-methyl-N-(4-methylpentan-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 79516852) has the molecular formula C16H21FN2OS and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-methyl-N-(4-methylpentan-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-fluoro-N-methyl-N-(4-methylpentan-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79516852 |
| Molecular Formula | C16H21FN2OS |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-amino-4-fluoro-N-methyl-N-(4-methylpentan-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)CC(C)N(C)C(=O)c1sc2cccc(F)c2c1N |
| InChI | InChI=1S/C16H21FN2OS/c1-9(2)8-10(3)19(4)16(20)15-14(18)13-11(17)6-5-7-12(13)21-15/h5-7,9-10H,8,18H2,1-4H3 |
| InChIKey | ZNRRKNLQVXJXIG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |