C15H13FN2OS2 — CID 79517764
3-amino-4-fluoro-N-methyl-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 79517764) has the molecular formula C15H13FN2OS2 and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-methyl-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-fluoro-N-methyl-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79517764 |
| Molecular Formula | C15H13FN2OS2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-amino-4-fluoro-N-methyl-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CN(Cc1ccsc1)C(=O)c1sc2cccc(F)c2c1N |
| InChI | InChI=1S/C15H13FN2OS2/c1-18(7-9-5-6-20-8-9)15(19)14-13(17)12-10(16)3-2-4-11(12)21-14/h2-6,8H,7,17H2,1H3 |
| InChIKey | OPBKYIPFQCQAND-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |