C13H15BrN2O2S — CID 114907804
3-amino-6-bromo-N-ethyl-N-(2-hydroxyethyl)-1-benzothiophene-2-carboxamide (PubChem CID 114907804) has the molecular formula C13H15BrN2O2S and a molecular weight of 343.25 g/mol. Its IUPAC name is 3-amino-6-bromo-N-ethyl-N-(2-hydroxyethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-bromo-N-ethyl-N-(2-hydroxyethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114907804 |
| Molecular Formula | C13H15BrN2O2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-amino-6-bromo-N-ethyl-N-(2-hydroxyethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CCO)C(=O)c1sc2cc(Br)ccc2c1N |
| InChI | InChI=1S/C13H15BrN2O2S/c1-2-16(5-6-17)13(18)12-11(15)9-4-3-8(14)7-10(9)19-12/h3-4,7,17H,2,5-6,15H2,1H3 |
| InChIKey | FMFQNFZWQGNIJP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |