C15H19BrN2O2S — CID 114891388
ethyl 1-(4-bromo-2-carbamothioylphenyl)piperidine-2-carboxylate (PubChem CID 114891388) has the molecular formula C15H19BrN2O2S and a molecular weight of 371.30 g/mol. Its IUPAC name is ethyl 1-(4-bromo-2-carbamothioylphenyl)piperidine-2-carboxylate.
| Compound Name | ethyl 1-(4-bromo-2-carbamothioylphenyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 114891388 |
| Molecular Formula | C15H19BrN2O2S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | ethyl 1-(4-bromo-2-carbamothioylphenyl)piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1c1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C15H19BrN2O2S/c1-2-20-15(19)13-5-3-4-8-18(13)12-7-6-10(16)9-11(12)14(17)21/h6-7,9,13H,2-5,8H2,1H3,(H2,17,21) |
| InChIKey | NGBRKRGZMGODQG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|