C15H20N2O3S — CID 81298172
ethyl 1-(2-carbamothioyl-5-methoxyphenyl)pyrrolidine-2-carboxylate (PubChem CID 81298172) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is ethyl 1-(2-carbamothioyl-5-methoxyphenyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(2-carbamothioyl-5-methoxyphenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 81298172 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | ethyl 1-(2-carbamothioyl-5-methoxyphenyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1c1cc(OC)ccc1C(N)=S |
| InChI | InChI=1S/C15H20N2O3S/c1-3-20-15(18)12-5-4-8-17(12)13-9-10(19-2)6-7-11(13)14(16)21/h6-7,9,12H,3-5,8H2,1-2H3,(H2,16,21) |
| InChIKey | DDJCAKSGSAQUCM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|