C15H23BrN2S — CID 114891578
5-bromo-2-[butan-2-yl(butyl)amino]benzenecarbothioamide (PubChem CID 114891578) has the molecular formula C15H23BrN2S and a molecular weight of 343.33 g/mol. Its IUPAC name is 5-bromo-2-[butan-2-yl(butyl)amino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[butan-2-yl(butyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114891578 |
| Molecular Formula | C15H23BrN2S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 5-bromo-2-[butan-2-yl(butyl)amino]benzenecarbothioamide |
| SMILES | CCCCN(c1ccc(Br)cc1C(N)=S)C(C)CC |
| InChI | InChI=1S/C15H23BrN2S/c1-4-6-9-18(11(3)5-2)14-8-7-12(16)10-13(14)15(17)19/h7-8,10-11H,4-6,9H2,1-3H3,(H2,17,19) |
| InChIKey | VFSZCFRONZZIPD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|