C14H22BrN3S — CID 114891660
5-bromo-2-[2-(dimethylamino)ethyl-propylamino]benzenecarbothioamide (PubChem CID 114891660) has the molecular formula C14H22BrN3S and a molecular weight of 344.32 g/mol. Its IUPAC name is 5-bromo-2-[2-(dimethylamino)ethyl-propylamino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[2-(dimethylamino)ethyl-propylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114891660 |
| Molecular Formula | C14H22BrN3S |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 5-bromo-2-[2-(dimethylamino)ethyl-propylamino]benzenecarbothioamide |
| SMILES | CCCN(CCN(C)C)c1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C14H22BrN3S/c1-4-7-18(9-8-17(2)3)13-6-5-11(15)10-12(13)14(16)19/h5-6,10H,4,7-9H2,1-3H3,(H2,16,19) |
| InChIKey | SCGMRYYWTAILNX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|