C13H15BrN4OS — CID 114892577
5-bromo-N'-hydroxy-2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]benzenecarboximidamide (PubChem CID 114892577) has the molecular formula C13H15BrN4OS and a molecular weight of 355.26 g/mol. Its IUPAC name is 5-bromo-N'-hydroxy-2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]benzenecarboximidamide.
| Compound Name | 5-bromo-N'-hydroxy-2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 114892577 |
| Molecular Formula | C13H15BrN4OS |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 5-bromo-N'-hydroxy-2-[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]benzenecarboximidamide |
| SMILES | Cc1ncsc1CN(C)c1ccc(Br)cc1/C(N)=N/O |
| InChI | InChI=1S/C13H15BrN4OS/c1-8-12(20-7-16-8)6-18(2)11-4-3-9(14)5-10(11)13(15)17-19/h3-5,7,19H,6H2,1-2H3,(H2,15,17) |
| InChIKey | VMNXWCHZJQRGBP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|