C13H10BrCl2NS — CID 114893865
[5-bromo-2-(3,4-dichlorophenyl)sulfanylphenyl]methanamine (PubChem CID 114893865) has the molecular formula C13H10BrCl2NS and a molecular weight of 363.11 g/mol. Its IUPAC name is [5-bromo-2-(3,4-dichlorophenyl)sulfanylphenyl]methanamine.
| Compound Name | [5-bromo-2-(3,4-dichlorophenyl)sulfanylphenyl]methanamine |
|---|---|
| PubChem CID | 114893865 |
| Molecular Formula | C13H10BrCl2NS |
| Molecular Weight | 363.11 g/mol |
| Exact Mass | 360.91 |
| IUPAC Name | [5-bromo-2-(3,4-dichlorophenyl)sulfanylphenyl]methanamine |
| SMILES | NCc1cc(Br)ccc1Sc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10BrCl2NS/c14-9-1-4-13(8(5-9)7-17)18-10-2-3-11(15)12(16)6-10/h1-6H,7,17H2 |
| InChIKey | YXUOVHXGQXJMTG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.11 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |