C17H27BrFN — CID 114894944
1-(5-bromo-2-fluorophenyl)-N,3-diethylheptan-1-amine (PubChem CID 114894944) has the molecular formula C17H27BrFN and a molecular weight of 344.31 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-N,3-diethylheptan-1-amine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-N,3-diethylheptan-1-amine |
|---|---|
| PubChem CID | 114894944 |
| Molecular Formula | C17H27BrFN |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-N,3-diethylheptan-1-amine |
| SMILES | CCCCC(CC)CC(NCC)c1cc(Br)ccc1F |
| InChI | InChI=1S/C17H27BrFN/c1-4-7-8-13(5-2)11-17(20-6-3)15-12-14(18)9-10-16(15)19/h9-10,12-13,17,20H,4-8,11H2,1-3H3 |
| InChIKey | HOPZMBSKIVHIKI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |