C18H30FNO — CID 81301494
N,3-diethyl-1-(2-fluoro-4-methoxyphenyl)heptan-1-amine (PubChem CID 81301494) has the molecular formula C18H30FNO and a molecular weight of 295.44 g/mol. Its IUPAC name is N,3-diethyl-1-(2-fluoro-4-methoxyphenyl)heptan-1-amine.
| Compound Name | N,3-diethyl-1-(2-fluoro-4-methoxyphenyl)heptan-1-amine |
|---|---|
| PubChem CID | 81301494 |
| Molecular Formula | C18H30FNO |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N,3-diethyl-1-(2-fluoro-4-methoxyphenyl)heptan-1-amine |
| SMILES | CCCCC(CC)CC(NCC)c1ccc(OC)cc1F |
| InChI | InChI=1S/C18H30FNO/c1-5-8-9-14(6-2)12-18(20-7-3)16-11-10-15(21-4)13-17(16)19/h10-11,13-14,18,20H,5-9,12H2,1-4H3 |
| InChIKey | KWIXHADZGZIPTI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |