C15H24FNO3S — CID 81301655
N-ethyl-4-ethylsulfonyl-1-(2-fluoro-4-methoxyphenyl)butan-1-amine (PubChem CID 81301655) has the molecular formula C15H24FNO3S and a molecular weight of 317.43 g/mol. Its IUPAC name is N-ethyl-4-ethylsulfonyl-1-(2-fluoro-4-methoxyphenyl)butan-1-amine.
| Compound Name | N-ethyl-4-ethylsulfonyl-1-(2-fluoro-4-methoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 81301655 |
| Molecular Formula | C15H24FNO3S |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-ethyl-4-ethylsulfonyl-1-(2-fluoro-4-methoxyphenyl)butan-1-amine |
| SMILES | CCNC(CCCS(=O)(=O)CC)c1ccc(OC)cc1F |
| InChI | InChI=1S/C15H24FNO3S/c1-4-17-15(7-6-10-21(18,19)5-2)13-9-8-12(20-3)11-14(13)16/h8-9,11,15,17H,4-7,10H2,1-3H3 |
| InChIKey | NWDQCMJGERQNRP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |