C28H29N3O8 — CID 11489519
[(1S,2S,10R,12R,13R)-12-cyano-7,18-dimethoxy-6,17,21-trimethyl-5,8,16,19-tetraoxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl acetate (PubChem CID 11489519) has the molecular formula C28H29N3O8 and a molecular weight of 535.55 g/mol. Its IUPAC name is [(1S,2S,10R,12R,13R)-12-cyano-7,18-dimethoxy-6,17,21-trimethyl-5,8,16,19-tetraoxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl acetate.
| Compound Name | [(1S,2S,10R,12R,13R)-12-cyano-7,18-dimethoxy-6,17,21-trimethyl-5,8,16,19-tetraoxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl acetate |
|---|---|
| PubChem CID | 11489519 |
| Molecular Formula | C28H29N3O8 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | [(1S,2S,10R,12R,13R)-12-cyano-7,18-dimethoxy-6,17,21-trimethyl-5,8,16,19-tetraoxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl acetate |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)[C@H]1[C@@H]3CC4=C(C(=O)C(OC)=C(C)C4=O)[C@H](COC(C)=O)N3[C@@H](C#N)[C@@H](C2)N1C |
| InChI | InChI=1S/C28H29N3O8/c1-11-23(33)14-8-17-22-21-15(24(34)12(2)28(38-6)26(21)36)7-16(30(22)4)18(9-29)31(17)19(10-39-13(3)32)20(14)25(35)27(11)37-5/h16-19,22H,7-8,10H2,1-6H3/t16-,17+,18+,19+,22-/m1/s1 |
| InChIKey | NLVLCGZLXXPBHW-NOYKIMNZSA-N |
| XLogP | 0.71 |
| TPSA | 143.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|