C26H30N4O5 — CID 71020163
(1R,10R,12R,13S)-10-(aminomethyl)-19-hydroxy-7,18-dimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaene-12-carbonitrile (PubChem CID 71020163) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is (1R,10R,12R,13S)-10-(aminomethyl)-19-hydroxy-7,18-dimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaene-12-carbonitrile.
| Compound Name | (1R,10R,12R,13S)-10-(aminomethyl)-19-hydroxy-7,18-dimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaene-12-carbonitrile |
|---|---|
| PubChem CID | 71020163 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (1R,10R,12R,13S)-10-(aminomethyl)-19-hydroxy-7,18-dimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaene-12-carbonitrile |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)[C@H](CN)N1C(C2)[C@H]2c3c(cc(C)c(OC)c3O)C[C@@H]([C@@H]1C#N)N2C |
| InChI | InChI=1S/C26H30N4O5/c1-11-6-13-7-15-17(9-27)30-16(21(29(15)3)19(13)23(32)25(11)34-4)8-14-20(18(30)10-28)24(33)26(35-5)12(2)22(14)31/h6,15-18,21,32H,7-8,10,28H2,1-5H3/t15-,16?,17-,18-,21-/m0/s1 |
| InChIKey | OVTMUEDXAUUDOX-QHOFJDSZSA-N |
| XLogP | 1.28 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|