C28H35N3O6 — CID 148539871
N-[[(12S)-19-hydroxy-7,18-dimethoxy-6,12,17,21-tetramethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaen-10-yl]methyl]acetamide (PubChem CID 148539871) has the molecular formula C28H35N3O6 and a molecular weight of 509.60 g/mol. Its IUPAC name is N-[[(12S)-19-hydroxy-7,18-dimethoxy-6,12,17,21-tetramethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaen-10-yl]methyl]acetamide.
| Compound Name | N-[[(12S)-19-hydroxy-7,18-dimethoxy-6,12,17,21-tetramethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaen-10-yl]methyl]acetamide |
|---|---|
| PubChem CID | 148539871 |
| Molecular Formula | C28H35N3O6 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | N-[[(12S)-19-hydroxy-7,18-dimethoxy-6,12,17,21-tetramethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaen-10-yl]methyl]acetamide |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)C(CNC(C)=O)N1C(C2)C2c3c(cc(C)c(OC)c3O)CC([C@@H]1C)N2C |
| InChI | InChI=1S/C28H35N3O6/c1-12-8-16-9-18-14(3)31-19(23(30(18)5)21(16)25(34)27(12)36-6)10-17-22(20(31)11-29-15(4)32)26(35)28(37-7)13(2)24(17)33/h8,14,18-20,23,34H,9-11H2,1-7H3,(H,29,32)/t14-,18?,19?,20?,23?/m0/s1 |
| InChIKey | MRYMBCXWYCJKMI-VGUFLUDBSA-N |
| XLogP | 1.96 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|