C25H28N4O5 — CID 173496441
(10R,12R,13R)-10-(aminomethyl)-19-hydroxy-7,18-dimethoxy-6,17-dimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaene-12-carbonitrile (PubChem CID 173496441) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is (10R,12R,13R)-10-(aminomethyl)-19-hydroxy-7,18-dimethoxy-6,17-dimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaene-12-carbonitrile.
| Compound Name | (10R,12R,13R)-10-(aminomethyl)-19-hydroxy-7,18-dimethoxy-6,17-dimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaene-12-carbonitrile |
|---|---|
| PubChem CID | 173496441 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (10R,12R,13R)-10-(aminomethyl)-19-hydroxy-7,18-dimethoxy-6,17-dimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaene-12-carbonitrile |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)[C@H](CN)N1C(C2)C2N[C@H](Cc3cc(C)c(OC)c(O)c32)[C@@H]1C#N |
| InChI | InChI=1S/C25H28N4O5/c1-10-5-12-6-14-16(8-26)29-15(20(28-14)18(12)22(31)24(10)33-3)7-13-19(17(29)9-27)23(32)25(34-4)11(2)21(13)30/h5,14-17,20,28,31H,6-7,9,27H2,1-4H3/t14-,15?,16+,17+,20?/m1/s1 |
| InChIKey | NUSKFQDJHYUJEZ-QLARPANUSA-N |
| XLogP | 0.94 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|