C26H35N3O5 — CID 142096628
(1R)-6-(aminomethyl)-1-(2-hydroxy-3-methoxy-4,6-dimethylphenyl)-8-methoxy-2,3,9-trimethyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinoline-7,10-dione (PubChem CID 142096628) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is (1R)-6-(aminomethyl)-1-(2-hydroxy-3-methoxy-4,6-dimethylphenyl)-8-methoxy-2,3,9-trimethyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinoline-7,10-dione.
| Compound Name | (1R)-6-(aminomethyl)-1-(2-hydroxy-3-methoxy-4,6-dimethylphenyl)-8-methoxy-2,3,9-trimethyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinoline-7,10-dione |
|---|---|
| PubChem CID | 142096628 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | (1R)-6-(aminomethyl)-1-(2-hydroxy-3-methoxy-4,6-dimethylphenyl)-8-methoxy-2,3,9-trimethyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinoline-7,10-dione |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)C(CN)N1CC(C)N(C)[C@H](c3c(C)cc(C)c(OC)c3O)C1C2 |
| InChI | InChI=1S/C26H35N3O5/c1-12-8-13(2)25(33-6)23(31)19(12)21-17-9-16-20(24(32)26(34-7)15(4)22(16)30)18(10-27)29(17)11-14(3)28(21)5/h8,14,17-18,21,31H,9-11,27H2,1-7H3/t14?,17?,18?,21-/m0/s1 |
| InChIKey | DGTCUFRZFBNJMV-WZPDZCMGSA-N |
| XLogP | 2.16 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|