C29H37N3O10 — CID 10188643
(12,16,19-trihydroxy-7,14,18-trimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaen-10-yl)methyl 2-aminopropanoate (PubChem CID 10188643) has the molecular formula C29H37N3O10 and a molecular weight of 587.63 g/mol. Its IUPAC name is (12,16,19-trihydroxy-7,14,18-trimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaen-10-yl)methyl 2-aminopropanoate.
| Compound Name | (12,16,19-trihydroxy-7,14,18-trimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaen-10-yl)methyl 2-aminopropanoate |
|---|---|
| PubChem CID | 10188643 |
| Molecular Formula | C29H37N3O10 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | (12,16,19-trihydroxy-7,14,18-trimethoxy-6,17,21-trimethyl-5,8-dioxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),16,18-pentaen-10-yl)methyl 2-aminopropanoate |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)C(COC(=O)C(C)N)N1C(O)C3C(OC)c4c(O)c(C)c(OC)c(O)c4C(C1C2)N3C |
| InChI | InChI=1S/C29H37N3O10/c1-10-21(33)13-8-14-19-17-18(22(34)11(2)26(40-6)24(17)36)27(41-7)20(31(19)4)28(37)32(14)15(9-42-29(38)12(3)30)16(13)23(35)25(10)39-5/h12,14-15,19-20,27-28,34,36-37H,8-9,30H2,1-7H3 |
| InChIKey | CXILJPXJAOOUEG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 181.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|