C35H42N2O10 — CID 163111936
[14-ethoxy-7,18-dimethoxy-6,17,21-trimethyl-5,8,16,19-tetraoxo-12-(2-oxopropyl)-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl 2-methylbut-2-enoate (PubChem CID 163111936) has the molecular formula C35H42N2O10 and a molecular weight of 650.73 g/mol. Its IUPAC name is [14-ethoxy-7,18-dimethoxy-6,17,21-trimethyl-5,8,16,19-tetraoxo-12-(2-oxopropyl)-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl 2-methylbut-2-enoate.
| Compound Name | [14-ethoxy-7,18-dimethoxy-6,17,21-trimethyl-5,8,16,19-tetraoxo-12-(2-oxopropyl)-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163111936 |
| Molecular Formula | C35H42N2O10 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | [14-ethoxy-7,18-dimethoxy-6,17,21-trimethyl-5,8,16,19-tetraoxo-12-(2-oxopropyl)-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraen-10-yl]methyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OCC1C2=C(CC3C4C5=C(C(=O)C(C)=C(OC)C5=O)C(OCC)C(C(CC(C)=O)N13)N4C)C(=O)C(C)=C(OC)C2=O |
| InChI | InChI=1S/C35H42N2O10/c1-10-15(3)35(43)47-14-22-23-19(28(39)17(5)32(44-8)30(23)41)13-21-26-24-25(29(40)18(6)33(45-9)31(24)42)34(46-11-2)27(36(26)7)20(37(21)22)12-16(4)38/h10,20-22,26-27,34H,11-14H2,1-9H3 |
| InChIKey | OLLBAXAKBWEJLN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|