C28H32N2O8 — CID 163109349
10-(hydroxymethyl)-7,18-dimethoxy-6,17,21-trimethyl-12-(2-oxopropyl)-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraene-5,8,16,19-tetrone (PubChem CID 163109349) has the molecular formula C28H32N2O8 and a molecular weight of 524.57 g/mol. Its IUPAC name is 10-(hydroxymethyl)-7,18-dimethoxy-6,17,21-trimethyl-12-(2-oxopropyl)-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraene-5,8,16,19-tetrone.
| Compound Name | 10-(hydroxymethyl)-7,18-dimethoxy-6,17,21-trimethyl-12-(2-oxopropyl)-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraene-5,8,16,19-tetrone |
|---|---|
| PubChem CID | 163109349 |
| Molecular Formula | C28H32N2O8 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 10-(hydroxymethyl)-7,18-dimethoxy-6,17,21-trimethyl-12-(2-oxopropyl)-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),6,15(20),17-tetraene-5,8,16,19-tetrone |
| SMILES | COC1=C(C)C(=O)C2=C(C1=O)C1C3CC4=C(C(=O)C(OC)=C(C)C4=O)C(CO)N3C(CC(C)=O)C(C2)N1C |
| InChI | InChI=1S/C28H32N2O8/c1-11(32)7-17-16-8-15-21(26(36)28(38-6)13(3)24(15)34)22(29(16)4)18-9-14-20(19(10-31)30(17)18)25(35)27(37-5)12(2)23(14)33/h16-19,22,31H,7-10H2,1-6H3 |
| InChIKey | HKLYVBDGNSNYPK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|