C14H15BrN2O2S — CID 114896482
(3-amino-5-bromo-1-benzothiophen-2-yl)-[2-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 114896482) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is (3-amino-5-bromo-1-benzothiophen-2-yl)-[2-(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-amino-5-bromo-1-benzothiophen-2-yl)-[2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 114896482 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | (3-amino-5-bromo-1-benzothiophen-2-yl)-[2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | Nc1c(C(=O)N2CCCC2CO)sc2ccc(Br)cc12 |
| InChI | InChI=1S/C14H15BrN2O2S/c15-8-3-4-11-10(6-8)12(16)13(20-11)14(19)17-5-1-2-9(17)7-18/h3-4,6,9,18H,1-2,5,7,16H2 |
| InChIKey | LOSZXNKFLAFSLI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |