C14H14BrN3O2S — CID 114896382
1-(3-amino-5-bromo-1-benzothiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 114896382) has the molecular formula C14H14BrN3O2S and a molecular weight of 368.26 g/mol. Its IUPAC name is 1-(3-amino-5-bromo-1-benzothiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(3-amino-5-bromo-1-benzothiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 114896382 |
| Molecular Formula | C14H14BrN3O2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 1-(3-amino-5-bromo-1-benzothiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)c1sc2ccc(Br)cc2c1N |
| InChI | InChI=1S/C14H14BrN3O2S/c15-7-3-4-10-8(6-7)11(16)12(21-10)14(20)18-5-1-2-9(18)13(17)19/h3-4,6,9H,1-2,5,16H2,(H2,17,19) |
| InChIKey | HZSDYXVZKKFSBP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |