C14H11BrN2OS2 — CID 114896598
3-amino-5-bromo-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 114896598) has the molecular formula C14H11BrN2OS2 and a molecular weight of 367.29 g/mol. Its IUPAC name is 3-amino-5-bromo-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-5-bromo-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114896598 |
| Molecular Formula | C14H11BrN2OS2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 3-amino-5-bromo-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccsc2)sc2ccc(Br)cc12 |
| InChI | InChI=1S/C14H11BrN2OS2/c15-9-1-2-11-10(5-9)12(16)13(20-11)14(18)17-6-8-3-4-19-7-8/h1-5,7H,6,16H2,(H,17,18) |
| InChIKey | WRTFCJBZYOJJJF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |