C7H12N2O4 — CID 114896888
3-[(1-amino-1-oxopropan-2-yl)amino]-2-methyl-3-oxopropanoic acid (PubChem CID 114896888) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 3-[(1-amino-1-oxopropan-2-yl)amino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[(1-amino-1-oxopropan-2-yl)amino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114896888 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3-[(1-amino-1-oxopropan-2-yl)amino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(NC(=O)C(C)C(=O)O)C(N)=O |
| InChI | InChI=1S/C7H12N2O4/c1-3(7(12)13)6(11)9-4(2)5(8)10/h3-4H,1-2H3,(H2,8,10)(H,9,11)(H,12,13) |
| InChIKey | VNIWEQJQEGKEIO-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|