C9H13F3N2O4 — CID 114897590
2-methyl-3-[methyl-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]-3-oxopropanoic acid (PubChem CID 114897590) has the molecular formula C9H13F3N2O4 and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]-3-oxopropanoic acid.
| Compound Name | 2-methyl-3-[methyl-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114897590 |
| Molecular Formula | C9H13F3N2O4 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-methyl-3-[methyl-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)N(C)CC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O4/c1-5(8(17)18)7(16)14(2)3-6(15)13-4-9(10,11)12/h5H,3-4H2,1-2H3,(H,13,15)(H,17,18) |
| InChIKey | ALGVIHZXKZKCDF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|