C8H15NO4 — CID 114897796
3-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-methyl-3-oxopropanoic acid (PubChem CID 114897796) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114897796 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 3-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C8H15NO4/c1-5(7(12)13)6(11)9-8(2,3)4-10/h5,10H,4H2,1-3H3,(H,9,11)(H,12,13) |
| InChIKey | KRRQNICYXVUUKM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|