C11H12INO3 — CID 114897853
3-(3-iodo-4-methylanilino)-2-methyl-3-oxopropanoic acid (PubChem CID 114897853) has the molecular formula C11H12INO3 and a molecular weight of 333.13 g/mol. Its IUPAC name is 3-(3-iodo-4-methylanilino)-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-(3-iodo-4-methylanilino)-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114897853 |
| Molecular Formula | C11H12INO3 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 3-(3-iodo-4-methylanilino)-2-methyl-3-oxopropanoic acid |
| SMILES | Cc1ccc(NC(=O)C(C)C(=O)O)cc1I |
| InChI | InChI=1S/C11H12INO3/c1-6-3-4-8(5-9(6)12)13-10(14)7(2)11(15)16/h3-5,7H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | CXXQXXQEVIHHLV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|